Products 1346601-18-0
CAS 1346601-18-0 appears in our catalog under these names: Mesalamine-d3 HCl, 5–Aminosalicylic Acid–D3 hydrochloride, 5-Aminosalicylic Acid-d3 (hydrochloride), 99.00%. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 10mg, 5mg, 5 mg, 1 mg.
3-amino-2,4,5-trideuterio-6-hydroxybenzoic acid;hydrochloride (CAS 1346601-18-0) is a chemical compound with the molecular formula C7H8ClNO3 and a molecular weight of 192.61 g/mol. IUPAC name: 3-amino-2,4,5-trideuterio-6-hydroxybenzoic acid;hydrochloride. InChIKey: KKRSNTURHSOKTM-KADUPEOVSA-N.
| Molecular formula | C7H8ClNO3 |
|---|---|
| Molecular weight | 192.61 g/mol |
| IUPAC name | 3-amino-2,4,5-trideuterio-6-hydroxybenzoic acid;hydrochloride |
| InChIKey | KKRSNTURHSOKTM-KADUPEOVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])C(=O)O)O)[2H].Cl |
Computed by PubChem (NCBI)