CAS 1346601-29-3 is the registry number for 1-Hydroxy Valdecoxib-13C2,15N. Offered by: TRC. Available pack sizes: 25mg.
4-[5-(hydroxy(113C)methyl)-3-phenyl-(513C,215N)1,2-oxazol-4-yl]benzenesulfonamide (CAS 1346601-29-3) is a chemical compound with the molecular formula C16H14N2O4S and a molecular weight of 333.34 g/mol. IUPAC name: 4-[5-(hydroxy(113C)methyl)-3-phenyl-(513C,215N)1,2-oxazol-4-yl]benzenesulfonamide. InChIKey: UJSFKTUZOASIPA-URAPMWEKSA-N.
| Molecular formula | C16H14N2O4S |
|---|---|
| Molecular weight | 333.34 g/mol |
| IUPAC name | 4-[5-(hydroxy(113C)methyl)-3-phenyl-(513C,215N)1,2-oxazol-4-yl]benzenesulfonamide |
| InChIKey | UJSFKTUZOASIPA-URAPMWEKSA-N |
| SMILES | C1=CC=C(C=C1)C2=[15N]O[13C](=C2C3=CC=C(C=C3)S(=O)(=O)N)[13CH2]O |
Computed by PubChem (NCBI)