CAS 25840-58-8 is the registry number for 2-(1,3-Dioxo-1,3-dihydro-2h-isoindol-2-yl)-n-phenylethanesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(1,3-dioxoisoindol-2-yl)-N-phenylethanesulfonamide (CAS 25840-58-8) is a chemical compound with the molecular formula C16H14N2O4S and a molecular weight of 330.4 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)-N-phenylethanesulfonamide. InChIKey: HEOLTRSJABNMTP-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O4S |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 2-(1,3-dioxoisoindol-2-yl)-N-phenylethanesulfonamide |
| InChIKey | HEOLTRSJABNMTP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NS(=O)(=O)CCN2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)