CAS 6357-75-1 is the registry number for 8-Amino-5-((4-hydroxyphenyl)amino)-2-naphthalenesulfonic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 25mg.
8-amino-5-(4-hydroxyanilino)naphthalene-2-sulfonic acid (CAS 6357-75-1) is a chemical compound with the molecular formula C16H14N2O4S and a molecular weight of 330.4 g/mol. IUPAC name: 8-amino-5-(4-hydroxyanilino)naphthalene-2-sulfonic acid. InChIKey: CAUOCGDGBOJRSS-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O4S |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 8-amino-5-(4-hydroxyanilino)naphthalene-2-sulfonic acid |
| InChIKey | CAUOCGDGBOJRSS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=C3C=CC(=CC3=C(C=C2)N)S(=O)(=O)O)O |
Computed by PubChem (NCBI)