Products 6357-75-1

CAS 6357-75-1 is the registry number for 8-Amino-5-((4-hydroxyphenyl)amino)-2-naphthalenesulfonic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 25mg.

Structural formula: {0} (CAS {1})

8-amino-5-(4-hydroxyanilino)naphthalene-2-sulfonic acid (CAS 6357-75-1) is a chemical compound with the molecular formula C16H14N2O4S and a molecular weight of 330.4 g/mol. IUPAC name: 8-amino-5-(4-hydroxyanilino)naphthalene-2-sulfonic acid. InChIKey: CAUOCGDGBOJRSS-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14N2O4S
Molecular weight330.4 g/mol
IUPAC name8-amino-5-(4-hydroxyanilino)naphthalene-2-sulfonic acid
InChIKeyCAUOCGDGBOJRSS-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1NC2=C3C=CC(=CC3=C(C=C2)N)S(=O)(=O)O)O

Computed by PubChem (NCBI)