Products 1346601-46-4
CAS 1346601-46-4 appears in our catalog under these names: Bis(2-propylheptyl) Phthalate-d4, Bis(2–propylheptyl) phthalate–d4. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2500μg, 2.5 mg.
Bis(2-propylheptyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate (CAS 1346601-46-4) is a chemical compound with the molecular formula C28H46O4 and a molecular weight of 450.7 g/mol. IUPAC name: bis(2-propylheptyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate. InChIKey: MTYUOIVEVPTXFX-OLNJRPQYSA-N.
| Molecular formula | C28H46O4 |
|---|---|
| Molecular weight | 450.7 g/mol |
| IUPAC name | bis(2-propylheptyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| InChIKey | MTYUOIVEVPTXFX-OLNJRPQYSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OCC(CCC)CCCCC)C(=O)OCC(CCC)CCCCC)[2H])[2H] |
Computed by PubChem (NCBI)