Products 85851-81-6

CAS 85851-81-6 is the registry number for Bis(2-ethyloctyl) phthalate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Bis(2-ethyloctyl) benzene-1,2-dicarboxylate (CAS 85851-81-6) is a chemical compound with the molecular formula C28H46O4 and a molecular weight of 446.7 g/mol. IUPAC name: bis(2-ethyloctyl) benzene-1,2-dicarboxylate. InChIKey: ORKHXMGDPOGDKE-UHFFFAOYSA-N.

Identity
Molecular formulaC28H46O4
Molecular weight446.7 g/mol
IUPAC namebis(2-ethyloctyl) benzene-1,2-dicarboxylate
InChIKeyORKHXMGDPOGDKE-UHFFFAOYSA-N
SMILESCCCCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCCCC

Computed by PubChem (NCBI)