Products 316808-86-3

CAS 316808-86-3 is the registry number for Phthalic Acid Bis(3,7-dimethyloctyl) Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Bis(3,7-dimethyloctyl) benzene-1,2-dicarboxylate (CAS 316808-86-3) is a chemical compound with the molecular formula C28H46O4 and a molecular weight of 446.7 g/mol. IUPAC name: bis(3,7-dimethyloctyl) benzene-1,2-dicarboxylate. InChIKey: KVZQPXDGIYJYLU-UHFFFAOYSA-N.

Identity
Molecular formulaC28H46O4
Molecular weight446.7 g/mol
IUPAC namebis(3,7-dimethyloctyl) benzene-1,2-dicarboxylate
InChIKeyKVZQPXDGIYJYLU-UHFFFAOYSA-N
SMILESCC(C)CCCC(C)CCOC(=O)C1=CC=CC=C1C(=O)OCCC(C)CCCC(C)C

Computed by PubChem (NCBI)