Products 1346601-65-7
CAS 1346601-65-7 appears in our catalog under these names: Bupropion Impurity 4（Bupropion USP RC D）-d9, Deschloro Bupropion-d9 Hydrochloride. Offered by: Hubei YoungXin, TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 25 mg, 2.5 mg.
2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-1-phenylpropan-1-one;hydrochloride (CAS 1346601-65-7) is a chemical compound with the molecular formula C13H20ClNO and a molecular weight of 250.81 g/mol. IUPAC name: 2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-1-phenylpropan-1-one;hydrochloride. InChIKey: OXZBSTLIANDWJA-WWMMTMLWSA-N.
| Molecular formula | C13H20ClNO |
|---|---|
| Molecular weight | 250.81 g/mol |
| IUPAC name | 2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-1-phenylpropan-1-one;hydrochloride |
| InChIKey | OXZBSTLIANDWJA-WWMMTMLWSA-N |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])NC(C)C(=O)C1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)