CAS 1346602-38-7 appears in our catalog under these names: 4-(phenyl-13C6)butanoic acid, 98% 98%atom%13C, 4-Phenylbutyric Acid-13C6, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
4-((1,2,3,4,5,6-13C6)cyclohexatrienyl)butanoic acid (CAS 1346602-38-7) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 170.16 g/mol. IUPAC name: 4-((1,2,3,4,5,6-13C6)cyclohexatrienyl)butanoic acid. InChIKey: OBKXEAXTFZPCHS-SJOJKWQCSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 170.16 g/mol |
| IUPAC name | 4-((1,2,3,4,5,6-13C6)cyclohexatrienyl)butanoic acid |
| InChIKey | OBKXEAXTFZPCHS-SJOJKWQCSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)CCCC(=O)O |
Computed by PubChem (NCBI)