Products 358730-86-6
CAS 358730-86-6 appears in our catalog under these names: 4-Phenylbutyric Acid-d11, >95% (HPLC), 4-Phenylbutyric-d11 Acid, 98 atom % D, min 98% Chemical Purity, 4–Phenylbutyric acid–d11, 4-Phenylbutyric acid-d11, 99.30%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 0,5g, 0,25g, 25mg, 5mg, 50mg, 10 mg.
2,2,3,3,4,4-hexadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)butanoic acid (CAS 358730-86-6) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 175.27 g/mol. IUPAC name: 2,2,3,3,4,4-hexadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)butanoic acid. InChIKey: OBKXEAXTFZPCHS-VRWITDQQSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 175.27 g/mol |
| IUPAC name | 2,2,3,3,4,4-hexadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)butanoic acid |
| InChIKey | OBKXEAXTFZPCHS-VRWITDQQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)