Products 1346603-06-2
CAS 1346603-06-2 is the registry number for 2-Chloro Fenofibric Acid-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
2-[4-(2-chlorobenzoyl)phenoxy]-3,3,3-trideuterio-2-(trideuteriomethyl)propanoic acid (CAS 1346603-06-2) is a chemical compound with the molecular formula C17H15ClO4 and a molecular weight of 324.8 g/mol. IUPAC name: 2-[4-(2-chlorobenzoyl)phenoxy]-3,3,3-trideuterio-2-(trideuteriomethyl)propanoic acid. InChIKey: OTLZAXXVHHHGDU-WFGJKAKNSA-N.
| Molecular formula | C17H15ClO4 |
|---|---|
| Molecular weight | 324.8 g/mol |
| IUPAC name | 2-[4-(2-chlorobenzoyl)phenoxy]-3,3,3-trideuterio-2-(trideuteriomethyl)propanoic acid |
| InChIKey | OTLZAXXVHHHGDU-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)O)(C([2H])([2H])[2H])OC1=CC=C(C=C1)C(=O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)