CAS 61024-31-5 appears in our catalog under these names: Fenofibrate Impurity 20, 2-Chloro Fenofibric Acid, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 25mg.
2-[4-(2-chlorobenzoyl)phenoxy]-2-methylpropanoic acid (CAS 61024-31-5) is a chemical compound with the molecular formula C17H15ClO4 and a molecular weight of 318.7 g/mol. IUPAC name: 2-[4-(2-chlorobenzoyl)phenoxy]-2-methylpropanoic acid. InChIKey: OTLZAXXVHHHGDU-UHFFFAOYSA-N.
| Molecular formula | C17H15ClO4 |
|---|---|
| Molecular weight | 318.7 g/mol |
| IUPAC name | 2-[4-(2-chlorobenzoyl)phenoxy]-2-methylpropanoic acid |
| InChIKey | OTLZAXXVHHHGDU-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OC1=CC=C(C=C1)C(=O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)