Products 60012-96-6
CAS 60012-96-6 is the registry number for 3-Chloro Fenofibric Acid. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
2-[4-(3-chlorobenzoyl)phenoxy]-2-methylpropanoic acid (CAS 60012-96-6) is a chemical compound with the molecular formula C17H15ClO4 and a molecular weight of 318.7 g/mol. IUPAC name: 2-[4-(3-chlorobenzoyl)phenoxy]-2-methylpropanoic acid. InChIKey: JIWVJAFWQBLUTA-UHFFFAOYSA-N.
| Molecular formula | C17H15ClO4 |
|---|---|
| Molecular weight | 318.7 g/mol |
| IUPAC name | 2-[4-(3-chlorobenzoyl)phenoxy]-2-methylpropanoic acid |
| InChIKey | JIWVJAFWQBLUTA-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OC1=CC=C(C=C1)C(=O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-[4-(3-chlorobenzoyl)phenoxy]-2-methylpropanoic acid, 2-(4-(3-Chlorobenzoyl)phenoxy)-2-methylpropanoic acid, Propanoic acid, 2-(4-(3-chlorobenzoyl)phenoxy)-2-methyl-, 3-Chloro Fenofibric Acid, 2-[4-(3-Chlorobenzoyl)phenoxy]-2-methylpropanoic Acid; LF 406;, Fenofibrate Impurity 39, Fenofibrate Impurity N113