Products 1346603-11-9
CAS 1346603-11-9 is the registry number for N-Pentylindole-d11. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
1-(1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl)indole (CAS 1346603-11-9) is a chemical compound with the molecular formula C13H17N and a molecular weight of 198.35 g/mol. IUPAC name: 1-(1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl)indole. InChIKey: QWLCOOAYMQWDPR-QMUKGJFHSA-N.
| Molecular formula | C13H17N |
|---|---|
| Molecular weight | 198.35 g/mol |
| IUPAC name | 1-(1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl)indole |
| InChIKey | QWLCOOAYMQWDPR-QMUKGJFHSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])N1C=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)