Products 1346603-50-6
CAS 1346603-50-6 appears in our catalog under these names: Nefopam-d3 N-Oxide, >95% (HPLC), Nefopam-d3 N-Oxide. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
5-oxido-1-phenyl-5-(trideuteriomethyl)-1,3,4,6-tetrahydro-2,5-benzoxazocin-5-ium (CAS 1346603-50-6) is a chemical compound with the molecular formula C17H19NO2 and a molecular weight of 272.36 g/mol. IUPAC name: 5-oxido-1-phenyl-5-(trideuteriomethyl)-1,3,4,6-tetrahydro-2,5-benzoxazocin-5-ium. InChIKey: ADOSMCNCNFMWSW-FIBGUPNXSA-N.
| Molecular formula | C17H19NO2 |
|---|---|
| Molecular weight | 272.36 g/mol |
| IUPAC name | 5-oxido-1-phenyl-5-(trideuteriomethyl)-1,3,4,6-tetrahydro-2,5-benzoxazocin-5-ium |
| InChIKey | ADOSMCNCNFMWSW-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])[N+]1(CCOC(C2=CC=CC=C2C1)C3=CC=CC=C3)[O-] |
Computed by PubChem (NCBI)