CAS 66091-32-5 appears in our catalog under these names: (lR,5R)/(lS,5S)-Nefopam N-Oxide, Nefopam N-Oxide, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
5-methyl-5-oxido-1-phenyl-1,3,4,6-tetrahydro-2,5-benzoxazocin-5-ium (CAS 66091-32-5) is a chemical compound with the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. IUPAC name: 5-methyl-5-oxido-1-phenyl-1,3,4,6-tetrahydro-2,5-benzoxazocin-5-ium. InChIKey: ADOSMCNCNFMWSW-UHFFFAOYSA-N.
| Molecular formula | C17H19NO2 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 5-methyl-5-oxido-1-phenyl-1,3,4,6-tetrahydro-2,5-benzoxazocin-5-ium |
| InChIKey | ADOSMCNCNFMWSW-UHFFFAOYSA-N |
| SMILES | C[N+]1(CCOC(C2=CC=CC=C2C1)C3=CC=CC=C3)[O-] |
Computed by PubChem (NCBI)