Products 1346603-54-0
CAS 1346603-54-0 is the registry number for 4-Formyl Antipyrine-d3. Offered by: TRC. Available pack sizes: 25mg.
3-methyl-5-oxo-1-phenyl-2-(trideuteriomethyl)pyrazole-4-carbaldehyde (CAS 1346603-54-0) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 219.25 g/mol. IUPAC name: 3-methyl-5-oxo-1-phenyl-2-(trideuteriomethyl)pyrazole-4-carbaldehyde. InChIKey: QFYZFYDOEJZMDX-BMSJAHLVSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 219.25 g/mol |
| IUPAC name | 3-methyl-5-oxo-1-phenyl-2-(trideuteriomethyl)pyrazole-4-carbaldehyde |
| InChIKey | QFYZFYDOEJZMDX-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=C(C(=O)N1C2=CC=CC=C2)C=O)C |
Computed by PubChem (NCBI)