CAS 1346603-85-7 appears in our catalog under these names: 7-Aminonimetazepam-d3, 7–Amino Nimetazepam–d3, 7-Amino Nimetazepam-d3, >95% (HPLC), 7-Amino Nimetazepam-d3 (1.0mg/ml in Acetonitrile). Offered by: MedChemExpress, GLPBio, TRC. Available pack sizes: 1 mg, 10 mg, 10mg, 1mg, 1x1ml.
7-amino-5-phenyl-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one (CAS 1346603-85-7) is a chemical compound with the molecular formula C16H15N3O and a molecular weight of 268.33 g/mol. IUPAC name: 7-amino-5-phenyl-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one. InChIKey: OALPQSAJOMDTDB-FIBGUPNXSA-N.
| Molecular formula | C16H15N3O |
|---|---|
| Molecular weight | 268.33 g/mol |
| IUPAC name | 7-amino-5-phenyl-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one |
| InChIKey | OALPQSAJOMDTDB-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=O)CN=C(C2=C1C=CC(=C2)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)