Products 1346604-19-0
CAS 1346604-19-0 appears in our catalog under these names: rac Diacetolol-d7, Diacetolol D7, Diacetolol D7, Diacetolol-d7. Offered by: TRC, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, 1 mg.
N-[3-acetyl-4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]acetamide (CAS 1346604-19-0) is a chemical compound with the molecular formula C16H24N2O4 and a molecular weight of 315.42 g/mol. IUPAC name: N-[3-acetyl-4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]acetamide. InChIKey: AWOGXJOBNAWQSF-SVMCCORHSA-N.
| Molecular formula | C16H24N2O4 |
|---|---|
| Molecular weight | 315.42 g/mol |
| IUPAC name | N-[3-acetyl-4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]acetamide |
| InChIKey | AWOGXJOBNAWQSF-SVMCCORHSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(COC1=C(C=C(C=C1)NC(=O)C)C(=O)C)O |
Computed by PubChem (NCBI)