Products 1346604-78-1

CAS 1346604-78-1 is the registry number for Flurbiprofen Impurity 22. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[4-(3,4-dimethoxyphenyl)-3-fluorophenyl]acetic acid (CAS 1346604-78-1) is a chemical compound with the molecular formula C16H15FO4 and a molecular weight of 290.29 g/mol. IUPAC name: 2-[4-(3,4-dimethoxyphenyl)-3-fluorophenyl]acetic acid. InChIKey: LJWFXMPMXFMHKS-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15FO4
Molecular weight290.29 g/mol
IUPAC name2-[4-(3,4-dimethoxyphenyl)-3-fluorophenyl]acetic acid
InChIKeyLJWFXMPMXFMHKS-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C2=C(C=C(C=C2)CC(=O)O)F)OC

Computed by PubChem (NCBI)