CAS 1346604-78-1 is the registry number for Flurbiprofen Impurity 22. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(3,4-dimethoxyphenyl)-3-fluorophenyl]acetic acid (CAS 1346604-78-1) is a chemical compound with the molecular formula C16H15FO4 and a molecular weight of 290.29 g/mol. IUPAC name: 2-[4-(3,4-dimethoxyphenyl)-3-fluorophenyl]acetic acid. InChIKey: LJWFXMPMXFMHKS-UHFFFAOYSA-N.
| Molecular formula | C16H15FO4 |
|---|---|
| Molecular weight | 290.29 g/mol |
| IUPAC name | 2-[4-(3,4-dimethoxyphenyl)-3-fluorophenyl]acetic acid |
| InChIKey | LJWFXMPMXFMHKS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(C=C(C=C2)CC(=O)O)F)OC |
Computed by PubChem (NCBI)