Products 915918-44-4

CAS 915918-44-4 is the registry number for 3-Ethoxy-4-[(3-fluorobenzyl)oxy]benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

3-ethoxy-4-[(3-fluorophenyl)methoxy]benzoic acid (CAS 915918-44-4) is a chemical compound with the molecular formula C16H15FO4 and a molecular weight of 290.29 g/mol. IUPAC name: 3-ethoxy-4-[(3-fluorophenyl)methoxy]benzoic acid. InChIKey: OLQWAAJKACCJQF-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15FO4
Molecular weight290.29 g/mol
IUPAC name3-ethoxy-4-[(3-fluorophenyl)methoxy]benzoic acid
InChIKeyOLQWAAJKACCJQF-UHFFFAOYSA-N
SMILESCCOC1=C(C=CC(=C1)C(=O)O)OCC2=CC(=CC=C2)F

Computed by PubChem (NCBI)