CAS 1820711-24-7 is the registry number for methyl 3-(2,4-dimethoxyphenyl)-5-fluorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 3-(2,4-dimethoxyphenyl)-5-fluorobenzoate (CAS 1820711-24-7) is a chemical compound with the molecular formula C16H15FO4 and a molecular weight of 290.29 g/mol. IUPAC name: methyl 3-(2,4-dimethoxyphenyl)-5-fluorobenzoate. InChIKey: YQHCXOXGJKGAIA-UHFFFAOYSA-N.
| Molecular formula | C16H15FO4 |
|---|---|
| Molecular weight | 290.29 g/mol |
| IUPAC name | methyl 3-(2,4-dimethoxyphenyl)-5-fluorobenzoate |
| InChIKey | YQHCXOXGJKGAIA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2=CC(=CC(=C2)F)C(=O)OC)OC |
Computed by PubChem (NCBI)