CAS 1346606-77-6 is the registry number for 16-Hydroxy Capsaicin-D₃. Offered by: TRC. Available pack sizes: 25mg.
(E)-8-hydroxy-N-[[4-hydroxy-3-(trideuteriomethoxy)phenyl]methyl]-8-methylnon-6-enamide (CAS 1346606-77-6) is a chemical compound with the molecular formula C18H27NO4 and a molecular weight of 324.4 g/mol. IUPAC name: (E)-8-hydroxy-N-[[4-hydroxy-3-(trideuteriomethoxy)phenyl]methyl]-8-methylnon-6-enamide. InChIKey: OGBQQOBPAFILCJ-WQEAERHDSA-N.
| Molecular formula | C18H27NO4 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | (E)-8-hydroxy-N-[[4-hydroxy-3-(trideuteriomethoxy)phenyl]methyl]-8-methylnon-6-enamide |
| InChIKey | OGBQQOBPAFILCJ-WQEAERHDSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)CNC(=O)CCCC/C=C/C(C)(C)O)O |
Computed by PubChem (NCBI)