Products 1346608-76-1
CAS 1346608-76-1 appears in our catalog under these names: 4–(3–Hydroxyoxetan–3–yl)benzoic acid, 4-(3-Hydroxyoxetan-3-yl)benzoic acid, 4-(3-Hydroxyoxetan-3-yl)benzoic acid, 95%, 95%, 4-(3-HYDROXYOXETAN-3-YL)BENZOIC ACID, 98%, 4-(3-Hydroxyoxetan-3-yl)benzoic acid, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 0,5g, 5g, 250mg, 1g.
4-(3-hydroxyoxetan-3-yl)benzoic acid (CAS 1346608-76-1) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 4-(3-hydroxyoxetan-3-yl)benzoic acid. InChIKey: YCQNBUUXBNUQHS-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 4-(3-hydroxyoxetan-3-yl)benzoic acid |
| InChIKey | YCQNBUUXBNUQHS-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=CC=C(C=C2)C(=O)O)O |
Computed by PubChem (NCBI)