Products 1346617-30-8
CAS 1346617-30-8 appears in our catalog under these names: Citalopram Impurity 22（EsCitalopram EP Impurity L）, Escitalopram impurity 1. Offered by: Hubei YoungXin, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, Get quote.
(1S)-1-[3-(dimethylamino)propyl]-1-phenyl-3H-2-benzofuran-5-carbonitrile (CAS 1346617-30-8) is a chemical compound with the molecular formula C20H22N2O and a molecular weight of 306.4 g/mol. IUPAC name: (1S)-1-[3-(dimethylamino)propyl]-1-phenyl-3H-2-benzofuran-5-carbonitrile. InChIKey: DCABXDIJRCWHAL-FQEVSTJZSA-N.
| Molecular formula | C20H22N2O |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | (1S)-1-[3-(dimethylamino)propyl]-1-phenyl-3H-2-benzofuran-5-carbonitrile |
| InChIKey | DCABXDIJRCWHAL-FQEVSTJZSA-N |
| SMILES | CN(C)CCC[C@@]1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)