CAS 1587636-55-2 is the registry number for Medetomidine Impurity 49. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1-benzylimidazol-4-yl)-1-(2,3-dimethylphenyl)ethanol (CAS 1587636-55-2) is a chemical compound with the molecular formula C20H22N2O and a molecular weight of 306.4 g/mol. IUPAC name: 1-(1-benzylimidazol-4-yl)-1-(2,3-dimethylphenyl)ethanol. InChIKey: AOCQPPSKHGUSFB-UHFFFAOYSA-N.
| Molecular formula | C20H22N2O |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 1-(1-benzylimidazol-4-yl)-1-(2,3-dimethylphenyl)ethanol |
| InChIKey | AOCQPPSKHGUSFB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(C)(C2=CN(C=N2)CC3=CC=CC=C3)O)C |
Computed by PubChem (NCBI)