CAS 401632-70-0 is the registry number for 3-(1-Adamantyl)-1-phenyl-1h-pyrazole-4-carbaldehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-(1-adamantyl)-1-phenylpyrazole-4-carbaldehyde (CAS 401632-70-0) is a chemical compound with the molecular formula C20H22N2O and a molecular weight of 306.4 g/mol. IUPAC name: 3-(1-adamantyl)-1-phenylpyrazole-4-carbaldehyde. InChIKey: JJUDUQXQEOVISD-UHFFFAOYSA-N.
| Molecular formula | C20H22N2O |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 3-(1-adamantyl)-1-phenylpyrazole-4-carbaldehyde |
| InChIKey | JJUDUQXQEOVISD-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=NN(C=C4C=O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)