Products 13467-26-0
CAS 13467-26-0 appears in our catalog under these names: H-Gly-Phe-NH2 acetate salt, Gly-Phe-NH2• AcOH. Offered by: Biosynth. Available pack sizes: 5g, 10g, 1g, 0,1g, 25g.
Acetic acid;2-[(2-aminoacetyl)amino]-3-phenylpropanamide (CAS 13467-26-0) is a chemical compound with the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. IUPAC name: acetic acid;2-[(2-aminoacetyl)amino]-3-phenylpropanamide. InChIKey: UFYWNVUEIJKEMY-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O4 |
|---|---|
| Molecular weight | 281.31 g/mol |
| IUPAC name | acetic acid;2-[(2-aminoacetyl)amino]-3-phenylpropanamide |
| InChIKey | UFYWNVUEIJKEMY-UHFFFAOYSA-N |
| SMILES | CC(=O)O.C1=CC=C(C=C1)CC(C(=O)N)NC(=O)CN |
Computed by PubChem (NCBI)