CAS 1346809-60-6 is the registry number for tert-Butyl 6-(trifluoromethyl)-3,4-dihydro-1,5-naphthyridine-1(2h)-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 6-(trifluoromethyl)-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate (CAS 1346809-60-6) is a chemical compound with the molecular formula C14H17F3N2O2 and a molecular weight of 302.29 g/mol. IUPAC name: tert-butyl 6-(trifluoromethyl)-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate. InChIKey: NLOUGBXTNNPIRV-UHFFFAOYSA-N.
| Molecular formula | C14H17F3N2O2 |
|---|---|
| Molecular weight | 302.29 g/mol |
| IUPAC name | tert-butyl 6-(trifluoromethyl)-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
| InChIKey | NLOUGBXTNNPIRV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2=C1C=CC(=N2)C(F)(F)F |
Computed by PubChem (NCBI)