CAS 2639373-25-2 is the registry number for Rel-benzyl (2R,5S)-5-amino-2-(trifluoromethyl)piperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2R,5S)-5-amino-2-(trifluoromethyl)piperidine-1-carboxylate (CAS 2639373-25-2) is a chemical compound with the molecular formula C14H17F3N2O2 and a molecular weight of 302.29 g/mol. IUPAC name: benzyl (2R,5S)-5-amino-2-(trifluoromethyl)piperidine-1-carboxylate. InChIKey: BLEHDONZDNLTQR-NWDGAFQWSA-N.
| Molecular formula | C14H17F3N2O2 |
|---|---|
| Molecular weight | 302.29 g/mol |
| IUPAC name | benzyl (2R,5S)-5-amino-2-(trifluoromethyl)piperidine-1-carboxylate |
| InChIKey | BLEHDONZDNLTQR-NWDGAFQWSA-N |
| SMILES | C1C[C@@H](N(C[C@H]1N)C(=O)OCC2=CC=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)