Products 1550007-54-9
CAS 1550007-54-9 is the registry number for 4-(4-Ethylpiperazin-1-yl)-3-(trifluoromethyl)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(4-ethylpiperazin-1-yl)-3-(trifluoromethyl)benzoic acid (CAS 1550007-54-9) is a chemical compound with the molecular formula C14H17F3N2O2 and a molecular weight of 302.29 g/mol. IUPAC name: 4-(4-ethylpiperazin-1-yl)-3-(trifluoromethyl)benzoic acid. InChIKey: GPCQZIDITYXMON-UHFFFAOYSA-N.
| Molecular formula | C14H17F3N2O2 |
|---|---|
| Molecular weight | 302.29 g/mol |
| IUPAC name | 4-(4-ethylpiperazin-1-yl)-3-(trifluoromethyl)benzoic acid |
| InChIKey | GPCQZIDITYXMON-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)C2=C(C=C(C=C2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)