Products 1347108-58-0
CAS 1347108-58-0 is the registry number for 5-(Piperidin-1-ylcarbonyl)-1H-pyrazol-3-amine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
(3-amino-1H-pyrazol-5-yl)-piperidin-1-ylmethanone (CAS 1347108-58-0) is a chemical compound with the molecular formula C9H14N4O and a molecular weight of 194.23 g/mol. IUPAC name: (3-amino-1H-pyrazol-5-yl)-piperidin-1-ylmethanone. InChIKey: JTDGJKCXZWOZAQ-UHFFFAOYSA-N.
| Molecular formula | C9H14N4O |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | (3-amino-1H-pyrazol-5-yl)-piperidin-1-ylmethanone |
| InChIKey | JTDGJKCXZWOZAQ-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=CC(=NN2)N |
Computed by PubChem (NCBI)