CAS 134749-43-2 appears in our catalog under these names: Terazosin Impurity 1 HCl (2-Hydroxy-4-Amino-6,7-Dimethoxy Quinazoline), 4-Amino-6,7-dimethoxy-1H-quinazolin-2-one hydrochloride, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 10mg, 25mg.
4-amino-6,7-dimethoxy-1H-quinazolin-2-one;hydrochloride (CAS 134749-43-2) is a chemical compound with the molecular formula C10H12ClN3O3 and a molecular weight of 257.67 g/mol. IUPAC name: 4-amino-6,7-dimethoxy-1H-quinazolin-2-one;hydrochloride. InChIKey: DRRJLUGFNPKNAP-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3O3 |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | 4-amino-6,7-dimethoxy-1H-quinazolin-2-one;hydrochloride |
| InChIKey | DRRJLUGFNPKNAP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC(=O)N2)N)OC.Cl |
Computed by PubChem (NCBI)