CAS 1579955-32-0 is the registry number for Ethyl (2Z)-2-Chloro-2-[2-(6-methoxypyridin-3-yl)hydrazin-1-ylidene]acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
Ethyl (2Z)-2-chloro-2-[(6-methoxy-3-pyridinyl)hydrazinylidene]acetate (CAS 1579955-32-0) is a chemical compound with the molecular formula C10H12ClN3O3 and a molecular weight of 257.67 g/mol. IUPAC name: ethyl (2Z)-2-chloro-2-[(6-methoxy-3-pyridinyl)hydrazinylidene]acetate. InChIKey: ZUZXRIHQZQQHPS-ZROIWOOFSA-N.
| Molecular formula | C10H12ClN3O3 |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | ethyl (2Z)-2-chloro-2-[(6-methoxy-3-pyridinyl)hydrazinylidene]acetate |
| InChIKey | ZUZXRIHQZQQHPS-ZROIWOOFSA-N |
| SMILES | CCOC(=O)/C(=N/NC1=CN=C(C=C1)OC)/Cl |
Computed by PubChem (NCBI)