Products 1456103-81-3
CAS 1456103-81-3 is the registry number for (5-Chloro-2-isopropylpyrimidine-4-carbonyl)glycine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(5-chloro-2-propan-2-ylpyrimidine-4-carbonyl)amino]acetic acid (CAS 1456103-81-3) is a chemical compound with the molecular formula C10H12ClN3O3 and a molecular weight of 257.67 g/mol. IUPAC name: 2-[(5-chloro-2-propan-2-ylpyrimidine-4-carbonyl)amino]acetic acid. InChIKey: DUXBZVKMCFYWBY-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3O3 |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | 2-[(5-chloro-2-propan-2-ylpyrimidine-4-carbonyl)amino]acetic acid |
| InChIKey | DUXBZVKMCFYWBY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC=C(C(=N1)C(=O)NCC(=O)O)Cl |
Computed by PubChem (NCBI)