Products 1347740-86-6

CAS 1347740-86-6 is the registry number for Benzyl glutaminate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Benzyl 2,5-diamino-5-oxopentanoate;hydrochloride (CAS 1347740-86-6) is a chemical compound with the molecular formula C12H17ClN2O3 and a molecular weight of 272.73 g/mol. IUPAC name: benzyl 2,5-diamino-5-oxopentanoate;hydrochloride. InChIKey: VWUBGABLTZAUKP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17ClN2O3
Molecular weight272.73 g/mol
IUPAC namebenzyl 2,5-diamino-5-oxopentanoate;hydrochloride
InChIKeyVWUBGABLTZAUKP-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)C(CCC(=O)N)N.Cl

Computed by PubChem (NCBI)