CAS 1347740-86-6 is the registry number for Benzyl glutaminate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl 2,5-diamino-5-oxopentanoate;hydrochloride (CAS 1347740-86-6) is a chemical compound with the molecular formula C12H17ClN2O3 and a molecular weight of 272.73 g/mol. IUPAC name: benzyl 2,5-diamino-5-oxopentanoate;hydrochloride. InChIKey: VWUBGABLTZAUKP-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O3 |
|---|---|
| Molecular weight | 272.73 g/mol |
| IUPAC name | benzyl 2,5-diamino-5-oxopentanoate;hydrochloride |
| InChIKey | VWUBGABLTZAUKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C(CCC(=O)N)N.Cl |
Computed by PubChem (NCBI)