Products 60521-89-3

CAS 60521-89-3 is the registry number for (S)-Ac-2-amino-3-(4-aminophenyl)propionic acid methyl ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl (2S)-2-acetamido-3-(4-aminophenyl)propanoate;hydrochloride (CAS 60521-89-3) is a chemical compound with the molecular formula C12H17ClN2O3 and a molecular weight of 272.73 g/mol. IUPAC name: methyl (2S)-2-acetamido-3-(4-aminophenyl)propanoate;hydrochloride. InChIKey: VDCIJUQAYQIYHB-MERQFXBCSA-N.

Identity
Molecular formulaC12H17ClN2O3
Molecular weight272.73 g/mol
IUPAC namemethyl (2S)-2-acetamido-3-(4-aminophenyl)propanoate;hydrochloride
InChIKeyVDCIJUQAYQIYHB-MERQFXBCSA-N
SMILESCC(=O)N[C@@H](CC1=CC=C(C=C1)N)C(=O)OC.Cl

Computed by PubChem (NCBI)