CAS 402929-49-1 appears in our catalog under these names: Bzl-asn-ome hydrochloride, 95%, (S)-Methyl 4-amino-2-(benzylamino)-4-oxobutanoate hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
Methyl (2S)-4-amino-2-(benzylamino)-4-oxobutanoate;hydrochloride (CAS 402929-49-1) is a chemical compound with the molecular formula C12H17ClN2O3 and a molecular weight of 272.73 g/mol. IUPAC name: methyl (2S)-4-amino-2-(benzylamino)-4-oxobutanoate;hydrochloride. InChIKey: QDFRLDCETLZVTL-PPHPATTJSA-N.
| Molecular formula | C12H17ClN2O3 |
|---|---|
| Molecular weight | 272.73 g/mol |
| IUPAC name | methyl (2S)-4-amino-2-(benzylamino)-4-oxobutanoate;hydrochloride |
| InChIKey | QDFRLDCETLZVTL-PPHPATTJSA-N |
| SMILES | COC(=O)[C@H](CC(=O)N)NCC1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)