CAS 13479-88-4 appears in our catalog under these names: 5,7–Dichlorothiazolo(5,4–d)pyrimidine, 5,7-Dichlorothiazolo[5,4-d]pyrimidine, 98%, 98%, 5,7-Dichlorothiazolo[5,4-d]pyrimidine, 99.93%, 5,7-Dichlorothiazolo[5,4-d]pyrimidine, 95%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 50mg, 500mg, 1g, 5g, 10g, 25g.
5,7-dichloro-[1,3]thiazolo[5,4-d]pyrimidine (CAS 13479-88-4) is a chemical compound with the molecular formula C5HCl2N3S and a molecular weight of 206.05 g/mol. IUPAC name: 5,7-dichloro-[1,3]thiazolo[5,4-d]pyrimidine. InChIKey: XYBGDWLYHQAUQM-UHFFFAOYSA-N.
| Molecular formula | C5HCl2N3S |
|---|---|
| Molecular weight | 206.05 g/mol |
| IUPAC name | 5,7-dichloro-[1,3]thiazolo[5,4-d]pyrimidine |
| InChIKey | XYBGDWLYHQAUQM-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(S1)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)