CAS 19602-61-0 appears in our catalog under these names: 2,7-Dichlorothiazolo(5,4-d)pyrimidine, 95%, 2,7-Dichloro-(1,3)thiazolo(5,4-d)pyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 50mg, 0,5g.
2,7-dichloro-[1,3]thiazolo[5,4-d]pyrimidine (CAS 19602-61-0) is a chemical compound with the molecular formula C5HCl2N3S and a molecular weight of 206.05 g/mol. IUPAC name: 2,7-dichloro-[1,3]thiazolo[5,4-d]pyrimidine. InChIKey: HIETVCLWXWMCSD-UHFFFAOYSA-N.
| Molecular formula | C5HCl2N3S |
|---|---|
| Molecular weight | 206.05 g/mol |
| IUPAC name | 2,7-dichloro-[1,3]thiazolo[5,4-d]pyrimidine |
| InChIKey | HIETVCLWXWMCSD-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(C(=N1)Cl)N=C(S2)Cl |
Computed by PubChem (NCBI)