CAS 13669-90-4 is the registry number for 4,7-Dichlorothiazolo(4,5-d)pyridazine, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
4,7-dichloro-[1,3]thiazolo[4,5-d]pyridazine (CAS 13669-90-4) is a chemical compound with the molecular formula C5HCl2N3S and a molecular weight of 206.05 g/mol. IUPAC name: 4,7-dichloro-[1,3]thiazolo[4,5-d]pyridazine. InChIKey: SDQRRNVFGWTOKK-UHFFFAOYSA-N.
| Molecular formula | C5HCl2N3S |
|---|---|
| Molecular weight | 206.05 g/mol |
| IUPAC name | 4,7-dichloro-[1,3]thiazolo[4,5-d]pyridazine |
| InChIKey | SDQRRNVFGWTOKK-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(S1)C(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)