CAS 134811-93-1 appears in our catalog under these names: 3-(4-Methyl-1,3-thiazol-2-yl)aniline, 95%, 3-(4-Methyl-1,3-thiazol-2-yl)aniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 0,5g.
3-(4-methyl-1,3-thiazol-2-yl)aniline (CAS 134811-93-1) is a chemical compound with the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. IUPAC name: 3-(4-methyl-1,3-thiazol-2-yl)aniline. InChIKey: GZBUVZDSQJFVBT-UHFFFAOYSA-N.
| Molecular formula | C10H10N2S |
|---|---|
| Molecular weight | 190.27 g/mol |
| IUPAC name | 3-(4-methyl-1,3-thiazol-2-yl)aniline |
| InChIKey | GZBUVZDSQJFVBT-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)