CAS 134896-35-8 appears in our catalog under these names: 3–Nitro–2–phenylpyridine, 3-Nitro-2-phenylpyridine 95%, 3-Nitro-2-phenylpyridine, 95%, 95%, 3-Nitro-2-phenylpyridine, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g.
3-nitro-2-phenylpyridine (CAS 134896-35-8) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 3-nitro-2-phenylpyridine. InChIKey: GEALTJGFPPNOJE-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 3-nitro-2-phenylpyridine |
| InChIKey | GEALTJGFPPNOJE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)