Products 13493-22-6
CAS 13493-22-6 is the registry number for N,N-Bis(1-methylethyl)-1-naphthalenecarboxamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N,N-di(propan-2-yl)naphthalene-1-carboxamide (CAS 13493-22-6) is a chemical compound with the molecular formula C17H21NO and a molecular weight of 255.35 g/mol. IUPAC name: N,N-di(propan-2-yl)naphthalene-1-carboxamide. InChIKey: JNVZRKQFMKMHFD-UHFFFAOYSA-N.
| Molecular formula | C17H21NO |
|---|---|
| Molecular weight | 255.35 g/mol |
| IUPAC name | N,N-di(propan-2-yl)naphthalene-1-carboxamide |
| InChIKey | JNVZRKQFMKMHFD-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=CC=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)