Products 1349716-23-9

CAS 1349716-23-9 is the registry number for 1-(Pyridin-2-yl)cyclopropane-1-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g.

Structural formula: {0} (CAS {1})

1-pyridin-2-ylcyclopropane-1-carboxylic acid;hydrochloride (CAS 1349716-23-9) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 1-pyridin-2-ylcyclopropane-1-carboxylic acid;hydrochloride. InChIKey: IRTVMHFIKMBENX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClNO2
Molecular weight199.63 g/mol
IUPAC name1-pyridin-2-ylcyclopropane-1-carboxylic acid;hydrochloride
InChIKeyIRTVMHFIKMBENX-UHFFFAOYSA-N
SMILESC1CC1(C2=CC=CC=N2)C(=O)O.Cl

Computed by PubChem (NCBI)