Products 1350219-74-7
CAS 1350219-74-7 appears in our catalog under these names: Varenicline Impurity 13 HCl, Varenicline Impurity 16. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4(9),10-triene-6,7-dione;hydrochloride (CAS 1350219-74-7) is a chemical compound with the molecular formula C13H14ClN3O2 and a molecular weight of 279.72 g/mol. IUPAC name: 5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4(9),10-triene-6,7-dione;hydrochloride. InChIKey: WPQFNRPPXPNQEK-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN3O2 |
|---|---|
| Molecular weight | 279.72 g/mol |
| IUPAC name | 5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4(9),10-triene-6,7-dione;hydrochloride |
| InChIKey | WPQFNRPPXPNQEK-UHFFFAOYSA-N |
| SMILES | C1C2CNCC1C3=CC4=C(C=C23)NC(=O)C(=O)N4.Cl |
Computed by PubChem (NCBI)