CAS 1346598-11-5 appears in our catalog under these names: Domperidone EP Impurity B, Domperidone Impurity B, Domperidone Impurity 2(Domperidone EP Impurity B), 4-(5-Chloro-2-oxo-2,3-dihydro-1H-benzimidazol-1-yl)-1-formylpiperidine, >95% (HPLC), 4-(5-Chloro-2-oxo-2,3-dihydro-1H-benzimidazol-1-yl)-1-formylpiperidine. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5g, 250mg.
4-(5-chloro-2-oxo-3H-benzimidazol-1-yl)piperidine-1-carbaldehyde (CAS 1346598-11-5) is a chemical compound with the molecular formula C13H14ClN3O2 and a molecular weight of 279.72 g/mol. IUPAC name: 4-(5-chloro-2-oxo-3H-benzimidazol-1-yl)piperidine-1-carbaldehyde. InChIKey: KVXFJSQPTDUFPA-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN3O2 |
|---|---|
| Molecular weight | 279.72 g/mol |
| IUPAC name | 4-(5-chloro-2-oxo-3H-benzimidazol-1-yl)piperidine-1-carbaldehyde |
| InChIKey | KVXFJSQPTDUFPA-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N2C3=C(C=C(C=C3)Cl)NC2=O)C=O |
Computed by PubChem (NCBI)