Products 1820740-45-1
CAS 1820740-45-1 is the registry number for 5-tert-butyl-1-(6-chloropyridin-2-yl)pyrazole-4-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-tert-butyl-1-(6-chloro-2-pyridinyl)pyrazole-4-carboxylic acid (CAS 1820740-45-1) is a chemical compound with the molecular formula C13H14ClN3O2 and a molecular weight of 279.72 g/mol. IUPAC name: 5-tert-butyl-1-(6-chloro-2-pyridinyl)pyrazole-4-carboxylic acid. InChIKey: HLPPWDVUSJWTSD-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN3O2 |
|---|---|
| Molecular weight | 279.72 g/mol |
| IUPAC name | 5-tert-butyl-1-(6-chloro-2-pyridinyl)pyrazole-4-carboxylic acid |
| InChIKey | HLPPWDVUSJWTSD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=NN1C2=NC(=CC=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)