CAS 2044702-29-4 appears in our catalog under these names: 3-([2,2'-Bipyridin]-5-yl)-2-aminopropanoic acid hydrochloride, 95%, 3–((2,2'–Bipyridin)–5–yl)–2–aminopropanoic acid hydrochloride, 3-(2,2'-Bipyridin-5-yl)alanine hydrochloride, 97%, 97%, 3-([2,2'-Bipyridin]-5-yl)-2-aminopropanoic acid hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 25mg, 5g, 50mg.
2-amino-3-(6-pyridin-2-yl-3-pyridinyl)propanoic acid;hydrochloride (CAS 2044702-29-4) is a chemical compound with the molecular formula C13H14ClN3O2 and a molecular weight of 279.72 g/mol. IUPAC name: 2-amino-3-(6-pyridin-2-yl-3-pyridinyl)propanoic acid;hydrochloride. InChIKey: YGFVUABWQMQJDI-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN3O2 |
|---|---|
| Molecular weight | 279.72 g/mol |
| IUPAC name | 2-amino-3-(6-pyridin-2-yl-3-pyridinyl)propanoic acid;hydrochloride |
| InChIKey | YGFVUABWQMQJDI-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NC=C(C=C2)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)