CAS 135043-64-0 appears in our catalog under these names: 2-Aminomethyl-4-aminophenol Dihydrochloride, 4-Amino-2-(aminomethyl)phenol dihydrochloride, 95+%. Offered by: TRC, AmBeed. Available pack sizes: 5g, 1g.
4-amino-2-(aminomethyl)phenol;dihydrochloride (CAS 135043-64-0) is a chemical compound with the molecular formula C7H12Cl2N2O and a molecular weight of 211.09 g/mol. IUPAC name: 4-amino-2-(aminomethyl)phenol;dihydrochloride. InChIKey: KNHWFUNNXGJVOZ-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N2O |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | 4-amino-2-(aminomethyl)phenol;dihydrochloride |
| InChIKey | KNHWFUNNXGJVOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)CN)O.Cl.Cl |
Computed by PubChem (NCBI)